C26H22F6N6O2S — CID 87321733
(2R)-4-[(5E)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-N-methylpiperazine-2-carboxamide (PubChem CID 87321733) has the molecular formula C26H22F6N6O2S and a molecular weight of 596.56 g/mol. Its IUPAC name is (2R)-4-[(5E)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-N-methylpiperazine-2-carboxamide.
| Compound Name | (2R)-4-[(5E)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-N-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 87321733 |
| Molecular Formula | C26H22F6N6O2S |
| Molecular Weight | 596.56 g/mol |
| Exact Mass | 596.14 |
| IUPAC Name | (2R)-4-[(5E)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-N-methylpiperazine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1CN(C2=NC(=O)/C(=C\c3ccc4c(cnn4Cc4ccc(C(F)(F)F)cc4C(F)(F)F)c3)S2)CCN1 |
| InChI | InChI=1S/C26H22F6N6O2S/c1-33-22(39)19-13-37(7-6-34-19)24-36-23(40)21(41-24)9-14-2-5-20-16(8-14)11-35-38(20)12-15-3-4-17(25(27,28)29)10-18(15)26(30,31)32/h2-5,8-11,19,34H,6-7,12-13H2,1H3,(H,33,39)/b21-9+/t19-/m1/s1 |
| InChIKey | OIXNYBKQNZYGDO-SMZVVKKCSA-N |
| XLogP | 4.11 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|