C29H27F6N5O2S — CID 86654604
5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]azetidin-1-yl]-1,3-thiazol-4-one (PubChem CID 86654604) has the molecular formula C29H27F6N5O2S and a molecular weight of 623.62 g/mol. Its IUPAC name is 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]azetidin-1-yl]-1,3-thiazol-4-one.
| Compound Name | 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]azetidin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 86654604 |
| Molecular Formula | C29H27F6N5O2S |
| Molecular Weight | 623.62 g/mol |
| Exact Mass | 623.18 |
| IUPAC Name | 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]azetidin-1-yl]-1,3-thiazol-4-one |
| SMILES | C[C@@H]1CN(C2CN(C3=NC(=O)C(=Cc4ccc5c(cnn5Cc5ccc(C(F)(F)F)cc5C(F)(F)F)c4)S3)C2)C[C@H](C)O1 |
| InChI | InChI=1S/C29H27F6N5O2S/c1-16-11-38(12-17(2)42-16)22-14-39(15-22)27-37-26(41)25(43-27)8-18-3-6-24-20(7-18)10-36-40(24)13-19-4-5-21(28(30,31)32)9-23(19)29(33,34)35/h3-10,16-17,22H,11-15H2,1-2H3/t16-,17+ |
| InChIKey | KJIGZIDNGBLZRV-CALCHBBNSA-N |
| XLogP | 5.89 |
| TPSA | 62.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|