C25H21F6N5O2S — CID 71617841
(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3S)-3-(hydroxymethyl)piperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 71617841) has the molecular formula C25H21F6N5O2S and a molecular weight of 569.53 g/mol. Its IUPAC name is (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3S)-3-(hydroxymethyl)piperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3S)-3-(hydroxymethyl)piperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 71617841 |
| Molecular Formula | C25H21F6N5O2S |
| Molecular Weight | 569.53 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3S)-3-(hydroxymethyl)piperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCN[C@H](CO)C2)S/C1=C\c1ccc2c(cnn2Cc2ccc(C(F)(F)F)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C25H21F6N5O2S/c26-24(27,28)17-3-2-15(19(9-17)25(29,30)31)11-36-20-4-1-14(7-16(20)10-33-36)8-21-22(38)34-23(39-21)35-6-5-32-18(12-35)13-37/h1-4,7-10,18,32,37H,5-6,11-13H2/b21-8-/t18-/m0/s1 |
| InChIKey | NHXOSBGITQBBCV-PXSLILGDSA-N |
| XLogP | 4.36 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|