C27H26F3N5OS — CID 58311542
(5Z)-5-[[1-[[4-cyclopropyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one (PubChem CID 58311542) has the molecular formula C27H26F3N5OS and a molecular weight of 525.60 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-cyclopropyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[1-[[4-cyclopropyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58311542 |
| Molecular Formula | C27H26F3N5OS |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | (5Z)-5-[[1-[[4-cyclopropyl-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one |
| SMILES | CN1CCN(C2=NC(=O)/C(=C/c3ccc4c(cnn4Cc4ccc(C5CC5)cc4C(F)(F)F)c3)S2)CC1 |
| InChI | InChI=1S/C27H26F3N5OS/c1-33-8-10-34(11-9-33)26-32-25(36)24(37-26)13-17-2-7-23-21(12-17)15-31-35(23)16-20-6-5-19(18-3-4-18)14-22(20)27(28,29)30/h2,5-7,12-15,18H,3-4,8-11,16H2,1H3/b24-13- |
| InChIKey | GNFDHFNXZQSRSR-CFRMEGHHSA-N |
| XLogP | 5.20 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|