C20H11F3N4O2S — CID 86659687
4-[[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indazol-1-yl]methyl]-3-(trifluoromethyl)benzonitrile (PubChem CID 86659687) has the molecular formula C20H11F3N4O2S and a molecular weight of 428.40 g/mol. Its IUPAC name is 4-[[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indazol-1-yl]methyl]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indazol-1-yl]methyl]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 86659687 |
| Molecular Formula | C20H11F3N4O2S |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 4-[[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indazol-1-yl]methyl]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(Cn2ncc3cc(/C=C4\SC(=O)NC4=O)ccc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H11F3N4O2S/c21-20(22,23)15-6-12(8-24)1-3-13(15)10-27-16-4-2-11(5-14(16)9-25-27)7-17-18(28)26-19(29)30-17/h1-7,9H,10H2,(H,26,28,29)/b17-7- |
| InChIKey | DFJZPHBVLSKYCB-IDUWFGFVSA-N |
| XLogP | 4.30 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|