C22H13F6N3O4S — CID 58530630
2-[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 58530630) has the molecular formula C22H13F6N3O4S and a molecular weight of 529.42 g/mol. Its IUPAC name is 2-[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 58530630 |
| Molecular Formula | C22H13F6N3O4S |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | 2-[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)S/C(=C\c2ccc3c(cnn3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C22H13F6N3O4S/c23-21(24,25)14-3-2-12(15(7-14)22(26,27)28)9-31-16-4-1-11(5-13(16)8-29-31)6-17-19(34)30(10-18(32)33)20(35)36-17/h1-8H,9-10H2,(H,32,33)/b17-6- |
| InChIKey | TYQHYNNOGSQYJV-FMQZQXMHSA-N |
| XLogP | 5.24 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|