C25H20F6N4O3S — CID 90307829
(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4S)-3-hydroxypiperidin-4-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 90307829) has the molecular formula C25H20F6N4O3S and a molecular weight of 570.52 g/mol. Its IUPAC name is (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4S)-3-hydroxypiperidin-4-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4S)-3-hydroxypiperidin-4-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 90307829 |
| Molecular Formula | C25H20F6N4O3S |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4S)-3-hydroxypiperidin-4-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc3c(cnn3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2)C(=O)N1[C@H]1CCNC[C@@H]1O |
| InChI | InChI=1S/C25H20F6N4O3S/c26-24(27,28)16-3-2-14(17(9-16)25(29,30)31)12-34-18-4-1-13(7-15(18)10-33-34)8-21-22(37)35(23(38)39-21)19-5-6-32-11-20(19)36/h1-4,7-10,19-20,32,36H,5-6,11-12H2/b21-8-/t19-,20-/m0/s1 |
| InChIKey | VXLIJSSQBGBOAQ-ACQZDVIFSA-N |
| XLogP | 4.88 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|