C25H19F7N4O2S — CID 123556161
5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4R)-4-fluoropiperidin-3-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 123556161) has the molecular formula C25H19F7N4O2S and a molecular weight of 572.51 g/mol. Its IUPAC name is 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4R)-4-fluoropiperidin-3-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4R)-4-fluoropiperidin-3-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123556161 |
| Molecular Formula | C25H19F7N4O2S |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4R)-4-fluoropiperidin-3-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc3c(cnn3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2)C(=O)N1[C@H]1CNCC[C@H]1F |
| InChI | InChI=1S/C25H19F7N4O2S/c26-18-5-6-33-11-20(18)36-22(37)21(39-23(36)38)8-13-1-4-19-15(7-13)10-34-35(19)12-14-2-3-16(24(27,28)29)9-17(14)25(30,31)32/h1-4,7-10,18,20,33H,5-6,11-12H2/t18-,20+/m1/s1 |
| InChIKey | IUSCZLFQBBSNNI-QUCCMNQESA-N |
| XLogP | 5.86 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|