C27H20F6N4O2S — CID 123209645
3-[(1S,5R)-8-azatricyclo[3.2.1.03,8]octan-3-yl]-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 123209645) has the molecular formula C27H20F6N4O2S and a molecular weight of 578.54 g/mol. Its IUPAC name is 3-[(1S,5R)-8-azatricyclo[3.2.1.03,8]octan-3-yl]-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(1S,5R)-8-azatricyclo[3.2.1.03,8]octan-3-yl]-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123209645 |
| Molecular Formula | C27H20F6N4O2S |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | 3-[(1S,5R)-8-azatricyclo[3.2.1.03,8]octan-3-yl]-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc3c(cnn3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2)C(=O)N1C12C[C@H]3CC[C@@H](C1)N32 |
| InChI | InChI=1S/C27H20F6N4O2S/c28-26(29,30)17-3-2-15(20(9-17)27(31,32)33)13-35-21-6-1-14(7-16(21)12-34-35)8-22-23(38)37(24(39)40-22)25-10-18-4-5-19(11-25)36(18)25/h1-3,6-9,12,18-19H,4-5,10-11,13H2/t18-,19+,25? |
| InChIKey | XZPTVKSKNJAGQL-OOEJVQDLSA-N |
| XLogP | 6.50 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|