C23H16F6N4O5S2 — CID 86659618
2-[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylsulfonylacetamide (PubChem CID 86659618) has the molecular formula C23H16F6N4O5S2 and a molecular weight of 606.53 g/mol. Its IUPAC name is 2-[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylsulfonylacetamide.
| Compound Name | 2-[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylsulfonylacetamide |
|---|---|
| PubChem CID | 86659618 |
| Molecular Formula | C23H16F6N4O5S2 |
| Molecular Weight | 606.53 g/mol |
| Exact Mass | 606.05 |
| IUPAC Name | 2-[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-methylsulfonylacetamide |
| SMILES | CS(=O)(=O)NC(=O)CN1C(=O)S/C(=C\c2ccc3c(cnn3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C23H16F6N4O5S2/c1-40(37,38)31-19(34)11-32-20(35)18(39-21(32)36)7-12-2-5-17-14(6-12)9-30-33(17)10-13-3-4-15(22(24,25)26)8-16(13)23(27,28)29/h2-9H,10-11H2,1H3,(H,31,34)/b18-7- |
| InChIKey | VYLZFCAFSZELRI-WSVATBPTSA-N |
| XLogP | 4.23 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|