C28H26F6N4O4S — CID 87278206
[(2S)-1-[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-2,3,3-trimethylbutan-2-yl]carbamic acid (PubChem CID 87278206) has the molecular formula C28H26F6N4O4S and a molecular weight of 628.60 g/mol. Its IUPAC name is [(2S)-1-[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-2,3,3-trimethylbutan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-2,3,3-trimethylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87278206 |
| Molecular Formula | C28H26F6N4O4S |
| Molecular Weight | 628.60 g/mol |
| Exact Mass | 628.16 |
| IUPAC Name | [(2S)-1-[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-2,3,3-trimethylbutan-2-yl]carbamic acid |
| SMILES | CC(C)(C)[C@@](C)(CN1C(=O)SC(=Cc2ccc3c(cnn3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2)C1=O)NC(=O)O |
| InChI | InChI=1S/C28H26F6N4O4S/c1-25(2,3)26(4,36-23(40)41)14-37-22(39)21(43-24(37)42)10-15-5-8-20-17(9-15)12-35-38(20)13-16-6-7-18(27(29,30)31)11-19(16)28(32,33)34/h5-12,36H,13-14H2,1-4H3,(H,40,41)/t26-/m1/s1 |
| InChIKey | UTTIFPGLASQWFS-AREMUKBSSA-N |
| XLogP | 7.23 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.60 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|