C23H14F6N2O4S — CID 90307534
2-[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 90307534) has the molecular formula C23H14F6N2O4S and a molecular weight of 528.43 g/mol. Its IUPAC name is 2-[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 90307534 |
| Molecular Formula | C23H14F6N2O4S |
| Molecular Weight | 528.43 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | 2-[(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)S/C(=C\c2ccc3c(ccn3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C23H14F6N2O4S/c24-22(25,26)15-3-2-14(16(9-15)23(27,28)29)10-30-6-5-13-7-12(1-4-17(13)30)8-18-20(34)31(11-19(32)33)21(35)36-18/h1-9H,10-11H2,(H,32,33)/b18-8- |
| InChIKey | RBOMOXPPVJPBSJ-LSCVHKIXSA-N |
| XLogP | 5.85 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|