C21H12F6N2O2S — CID 173048269
5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 173048269) has the molecular formula C21H12F6N2O2S and a molecular weight of 470.39 g/mol. Its IUPAC name is 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 173048269 |
| Molecular Formula | C21H12F6N2O2S |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc3c(ccn3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C21H12F6N2O2S/c22-20(23,24)14-3-2-13(15(9-14)21(25,26)27)10-29-6-5-12-7-11(1-4-16(12)29)8-17-18(30)28-19(31)32-17/h1-9H,10H2,(H,28,30,31) |
| InChIKey | KWIYISHLWBBDOK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|