C20H14F3N3O3S — CID 86659610
(5Z)-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 86659610) has the molecular formula C20H14F3N3O3S and a molecular weight of 433.41 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 86659610 |
| Molecular Formula | C20H14F3N3O3S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | (5Z)-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(Cn2ncc3cc(/C=C4\SC(=O)NC4=O)ccc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H14F3N3O3S/c1-29-14-4-3-12(15(8-14)20(21,22)23)10-26-16-5-2-11(6-13(16)9-24-26)7-17-18(27)25-19(28)30-17/h2-9H,10H2,1H3,(H,25,27,28)/b17-7- |
| InChIKey | HDWSGTRSXRWIAB-IDUWFGFVSA-N |
| XLogP | 4.44 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|