C24H16F6N2O4S — CID 76814737
methyl 2-[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 76814737) has the molecular formula C24H16F6N2O4S and a molecular weight of 542.46 g/mol. Its IUPAC name is methyl 2-[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 76814737 |
| Molecular Formula | C24H16F6N2O4S |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | methyl 2-[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COC(=O)CN1C(=O)SC(=Cc2ccc3c(ccn3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C24H16F6N2O4S/c1-36-20(33)12-32-21(34)19(37-22(32)35)9-13-2-5-18-14(8-13)6-7-31(18)11-15-3-4-16(23(25,26)27)10-17(15)24(28,29)30/h2-10H,11-12H2,1H3 |
| InChIKey | WWSVRSXNDODSQR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|