C23H19ClF3N5O3S — CID 76814470
2-[2-[5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethoxy]guanidine (PubChem CID 76814470) has the molecular formula C23H19ClF3N5O3S and a molecular weight of 537.95 g/mol. Its IUPAC name is 2-[2-[5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethoxy]guanidine.
| Compound Name | 2-[2-[5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethoxy]guanidine |
|---|---|
| PubChem CID | 76814470 |
| Molecular Formula | C23H19ClF3N5O3S |
| Molecular Weight | 537.95 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | 2-[2-[5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethoxy]guanidine |
| SMILES | NC(N)=NOCCN1C(=O)SC(=Cc2ccc3c(ccn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C23H19ClF3N5O3S/c24-16-3-2-15(17(11-16)23(25,26)27)12-31-6-5-14-9-13(1-4-18(14)31)10-19-20(33)32(22(34)36-19)7-8-35-30-21(28)29/h1-6,9-11H,7-8,12H2,(H4,28,29,30) |
| InChIKey | LYTZRVMACCCTOO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.95 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|