C24H22ClF3N4O3S — CID 123362632
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[2-(3-hydroxypropylamino)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 123362632) has the molecular formula C24H22ClF3N4O3S and a molecular weight of 538.98 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[2-(3-hydroxypropylamino)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[2-(3-hydroxypropylamino)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123362632 |
| Molecular Formula | C24H22ClF3N4O3S |
| Molecular Weight | 538.98 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[2-(3-hydroxypropylamino)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C(=O)N1CCNCCCO |
| InChI | InChI=1S/C24H22ClF3N4O3S/c25-18-4-3-16(19(12-18)24(26,27)28)14-32-20-5-2-15(10-17(20)13-30-32)11-21-22(34)31(23(35)36-21)8-7-29-6-1-9-33/h2-5,10-13,29,33H,1,6-9,14H2 |
| InChIKey | IPXLVPCHPBLZGE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.98 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|