C27H29ClF3N5O2S — CID 88874430
(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[2-[methyl-[2-(propylamino)ethyl]amino]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 88874430) has the molecular formula C27H29ClF3N5O2S and a molecular weight of 580.08 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[2-[methyl-[2-(propylamino)ethyl]amino]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[2-[methyl-[2-(propylamino)ethyl]amino]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 88874430 |
| Molecular Formula | C27H29ClF3N5O2S |
| Molecular Weight | 580.08 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[2-[methyl-[2-(propylamino)ethyl]amino]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCNCCN(C)CCN1C(=O)S/C(=C\c2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C27H29ClF3N5O2S/c1-3-8-32-9-10-34(2)11-12-35-25(37)24(39-26(35)38)14-18-4-7-23-20(13-18)16-33-36(23)17-19-5-6-21(28)15-22(19)27(29,30)31/h4-7,13-16,32H,3,8-12,17H2,1-2H3/b24-14- |
| InChIKey | UNJGZZSXYWSANB-OYKKKHCWSA-N |
| XLogP | 5.72 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.08 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|