C25H24ClF3N4O2S — CID 58530508
(5Z)-3-[(2S)-2-amino-4-methylpentyl]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58530508) has the molecular formula C25H24ClF3N4O2S and a molecular weight of 537.01 g/mol. Its IUPAC name is (5Z)-3-[(2S)-2-amino-4-methylpentyl]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(2S)-2-amino-4-methylpentyl]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58530508 |
| Molecular Formula | C25H24ClF3N4O2S |
| Molecular Weight | 537.01 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | (5Z)-3-[(2S)-2-amino-4-methylpentyl]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)C[C@H](N)CN1C(=O)S/C(=C\c2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C25H24ClF3N4O2S/c1-14(2)7-19(30)13-32-23(34)22(36-24(32)35)9-15-3-6-21-17(8-15)11-31-33(21)12-16-4-5-18(26)10-20(16)25(27,28)29/h3-6,8-11,14,19H,7,12-13,30H2,1-2H3/b22-9-/t19-/m0/s1 |
| InChIKey | HVEAJXGHXRDYSO-INQBOMSASA-N |
| XLogP | 6.17 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.01 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|