C21H17Cl2F3N4O2S — CID 86659616
3-(2-aminoethyl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 86659616) has the molecular formula C21H17Cl2F3N4O2S and a molecular weight of 517.36 g/mol. Its IUPAC name is 3-(2-aminoethyl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-(2-aminoethyl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 86659616 |
| Molecular Formula | C21H17Cl2F3N4O2S |
| Molecular Weight | 517.36 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 3-(2-aminoethyl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.NCCN1C(=O)SC(=Cc2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C21H16ClF3N4O2S.ClH/c22-15-3-2-13(16(9-15)21(23,24)25)11-29-17-4-1-12(7-14(17)10-27-29)8-18-19(30)28(6-5-26)20(31)32-18;/h1-4,7-10H,5-6,11,26H2;1H |
| InChIKey | CGSSAOGZVUIFMZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|