C23H14ClF3N4O2S2 — CID 76814668
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(1,3-thiazol-4-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 76814668) has the molecular formula C23H14ClF3N4O2S2 and a molecular weight of 534.97 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(1,3-thiazol-4-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(1,3-thiazol-4-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 76814668 |
| Molecular Formula | C23H14ClF3N4O2S2 |
| Molecular Weight | 534.97 g/mol |
| Exact Mass | 534.02 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(1,3-thiazol-4-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C(=O)N1Cc1cscn1 |
| InChI | InChI=1S/C23H14ClF3N4O2S2/c24-16-3-2-14(18(7-16)23(25,26)27)9-31-19-4-1-13(5-15(19)8-29-31)6-20-21(32)30(22(33)35-20)10-17-11-34-12-28-17/h1-8,11-12H,9-10H2 |
| InChIKey | KRLPBCWIPAVTQH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.97 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|