C23H15ClF3N5O2S — CID 76814563
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(1H-imidazol-2-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 76814563) has the molecular formula C23H15ClF3N5O2S and a molecular weight of 517.92 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(1H-imidazol-2-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(1H-imidazol-2-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 76814563 |
| Molecular Formula | C23H15ClF3N5O2S |
| Molecular Weight | 517.92 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(1H-imidazol-2-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C(=O)N1Cc1ncc[nH]1 |
| InChI | InChI=1S/C23H15ClF3N5O2S/c24-16-3-2-14(17(9-16)23(25,26)27)11-32-18-4-1-13(7-15(18)10-30-32)8-19-21(33)31(22(34)35-19)12-20-28-5-6-29-20/h1-10H,11-12H2,(H,28,29) |
| InChIKey | PQEOPFFNKQWANA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.92 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|