C24H22ClF3N4O2S — CID 76814456
3-(2-amino-3-methylbutyl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 76814456) has the molecular formula C24H22ClF3N4O2S and a molecular weight of 522.98 g/mol. Its IUPAC name is 3-(2-amino-3-methylbutyl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-(2-amino-3-methylbutyl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 76814456 |
| Molecular Formula | C24H22ClF3N4O2S |
| Molecular Weight | 522.98 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 3-(2-amino-3-methylbutyl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)C(N)CN1C(=O)SC(=Cc2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C24H22ClF3N4O2S/c1-13(2)19(29)12-31-22(33)21(35-23(31)34)8-14-3-6-20-16(7-14)10-30-32(20)11-15-4-5-17(25)9-18(15)24(26,27)28/h3-10,13,19H,11-12,29H2,1-2H3 |
| InChIKey | ASOUHFFKKZMHID-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.98 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|