C30H28F6N4O4S — CID 87277931
(2S)-2-[[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]-1-tert-butylpyrrolidin-1-ium-1-carboxylate (PubChem CID 87277931) has the molecular formula C30H28F6N4O4S and a molecular weight of 654.63 g/mol. Its IUPAC name is (2S)-2-[[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]-1-tert-butylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | (2S)-2-[[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]-1-tert-butylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 87277931 |
| Molecular Formula | C30H28F6N4O4S |
| Molecular Weight | 654.63 g/mol |
| Exact Mass | 654.17 |
| IUPAC Name | (2S)-2-[[5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]-1-tert-butylpyrrolidin-1-ium-1-carboxylate |
| SMILES | CC(C)(C)[N+]1(C(=O)[O-])CCC[C@H]1CN1C(=O)SC(=Cc2ccc3c(cnn3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C30H28F6N4O4S/c1-28(2,3)40(27(43)44)10-4-5-21(40)16-38-25(41)24(45-26(38)42)12-17-6-9-23-19(11-17)14-37-39(23)15-18-7-8-20(29(31,32)33)13-22(18)30(34,35)36/h6-9,11-14,21H,4-5,10,15-16H2,1-3H3/t21-,40?/m0/s1 |
| InChIKey | YZNNGVYINHYTSQ-IJMHSEOPSA-N |
| XLogP | 6.28 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|