C28H26ClF3N4O4S — CID 87278041
(3R)-1-tert-butyl-3-[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]pyrrolidin-1-ium-1-carboxylate (PubChem CID 87278041) has the molecular formula C28H26ClF3N4O4S and a molecular weight of 607.05 g/mol. Its IUPAC name is (3R)-1-tert-butyl-3-[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]pyrrolidin-1-ium-1-carboxylate.
| Compound Name | (3R)-1-tert-butyl-3-[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]pyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 87278041 |
| Molecular Formula | C28H26ClF3N4O4S |
| Molecular Weight | 607.05 g/mol |
| Exact Mass | 606.13 |
| IUPAC Name | (3R)-1-tert-butyl-3-[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]pyrrolidin-1-ium-1-carboxylate |
| SMILES | CC(C)(C)[N+]1(C(=O)[O-])CC[C@@H](N2C(=O)S/C(=C\c3ccc4c(cnn4Cc4ccc(Cl)cc4C(F)(F)F)c3)C2=O)C1 |
| InChI | InChI=1S/C28H26ClF3N4O4S/c1-27(2,3)36(26(39)40)9-8-20(15-36)35-24(37)23(41-25(35)38)11-16-4-7-22-18(10-16)13-33-34(22)14-17-5-6-19(29)12-21(17)28(30,31)32/h4-7,10-13,20H,8-9,14-15H2,1-3H3/b23-11-/t20-,36?/m1/s1 |
| InChIKey | IAPLACDWXPVPJX-JJDJVZCWSA-N |
| XLogP | 5.52 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.05 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|