C24H19ClF4N4O2S — CID 173048223
5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3R,4S)-4-fluoropiperidin-3-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 173048223) has the molecular formula C24H19ClF4N4O2S and a molecular weight of 538.95 g/mol. Its IUPAC name is 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3R,4S)-4-fluoropiperidin-3-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3R,4S)-4-fluoropiperidin-3-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 173048223 |
| Molecular Formula | C24H19ClF4N4O2S |
| Molecular Weight | 538.95 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3R,4S)-4-fluoropiperidin-3-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C(=O)N1[C@@H]1CNCC[C@@H]1F |
| InChI | InChI=1S/C24H19ClF4N4O2S/c25-16-3-2-14(17(9-16)24(27,28)29)12-32-19-4-1-13(7-15(19)10-31-32)8-21-22(34)33(23(35)36-21)20-11-30-6-5-18(20)26/h1-4,7-10,18,20,30H,5-6,11-12H2/t18-,20+/m0/s1 |
| InChIKey | QOFBTEHYBBDSDL-AZUAARDMSA-N |
| XLogP | 5.49 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.95 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|