C28H24F6N4O3S — CID 58530778
(5Z)-3-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58530778) has the molecular formula C28H24F6N4O3S and a molecular weight of 610.58 g/mol. Its IUPAC name is (5Z)-3-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58530778 |
| Molecular Formula | C28H24F6N4O3S |
| Molecular Weight | 610.58 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | (5Z)-3-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc3c(cnn3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2)C(=O)N1C[C@H]1CN2CCC[C@H]2CO1 |
| InChI | InChI=1S/C28H24F6N4O3S/c29-27(30,31)19-5-4-17(22(10-19)28(32,33)34)12-38-23-6-3-16(8-18(23)11-35-38)9-24-25(39)37(26(40)42-24)14-21-13-36-7-1-2-20(36)15-41-21/h3-6,8-11,20-21H,1-2,7,12-15H2/b24-9-/t20-,21+/m0/s1 |
| InChIKey | JMNBKFIRDMNDMV-XNKHIOHWSA-N |
| XLogP | 6.02 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|