C27H24ClF3N4O4S — CID 76814401
3-(3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-3-ylmethyl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 76814401) has the molecular formula C27H24ClF3N4O4S and a molecular weight of 593.03 g/mol. Its IUPAC name is 3-(3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-3-ylmethyl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-(3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-3-ylmethyl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 76814401 |
| Molecular Formula | C27H24ClF3N4O4S |
| Molecular Weight | 593.03 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | 3-(3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-3-ylmethyl)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C(=O)N1CC1CN2CCOCC2CO1 |
| InChI | InChI=1S/C27H24ClF3N4O4S/c28-19-3-2-17(22(9-19)27(29,30)31)11-35-23-4-1-16(7-18(23)10-32-35)8-24-25(36)34(26(37)40-24)13-21-12-33-5-6-38-14-20(33)15-39-21/h1-4,7-10,20-21H,5-6,11-15H2 |
| InChIKey | OEZYJWQPYXFIRM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.03 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|