C26H24ClF3N4O2S — CID 76814515
3-[(3-aminocyclohexyl)methyl]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 76814515) has the molecular formula C26H24ClF3N4O2S and a molecular weight of 549.02 g/mol. Its IUPAC name is 3-[(3-aminocyclohexyl)methyl]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(3-aminocyclohexyl)methyl]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 76814515 |
| Molecular Formula | C26H24ClF3N4O2S |
| Molecular Weight | 549.02 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | 3-[(3-aminocyclohexyl)methyl]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | NC1CCCC(CN2C(=O)SC(=Cc3ccc4c(cnn4Cc4ccc(Cl)cc4C(F)(F)F)c3)C2=O)C1 |
| InChI | InChI=1S/C26H24ClF3N4O2S/c27-19-6-5-17(21(11-19)26(28,29)30)14-34-22-7-4-15(8-18(22)12-32-34)10-23-24(35)33(25(36)37-23)13-16-2-1-3-20(31)9-16/h4-8,10-12,16,20H,1-3,9,13-14,31H2 |
| InChIKey | JXSIFZZEARUKNY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.02 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|