C24H20F3IN4O3S — CID 162589835
(5Z)-5-[[1-[[4-iodo-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(morpholin-3-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 162589835) has the molecular formula C24H20F3IN4O3S and a molecular weight of 628.41 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-iodo-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(morpholin-3-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[[4-iodo-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(morpholin-3-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 162589835 |
| Molecular Formula | C24H20F3IN4O3S |
| Molecular Weight | 628.41 g/mol |
| Exact Mass | 628.03 |
| IUPAC Name | (5Z)-5-[[1-[[4-iodo-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(morpholin-3-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc3c(cnn3Cc3ccc(I)cc3C(F)(F)F)c2)C(=O)N1CC1COCCN1 |
| InChI | InChI=1S/C24H20F3IN4O3S/c25-24(26,27)19-9-17(28)3-2-15(19)11-32-20-4-1-14(7-16(20)10-30-32)8-21-22(33)31(23(34)36-21)12-18-13-35-6-5-29-18/h1-4,7-10,18,29H,5-6,11-13H2/b21-8- |
| InChIKey | PHAGQUHAWNDNMQ-WNFQYIGGSA-N |
| XLogP | 4.73 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|