C13H10ClNO5S — CID 124641607
methyl 2-[(5E)-5-[(3-chloro-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 124641607) has the molecular formula C13H10ClNO5S and a molecular weight of 327.75 g/mol. Its IUPAC name is methyl 2-[(5E)-5-[(3-chloro-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[(5E)-5-[(3-chloro-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 124641607 |
| Molecular Formula | C13H10ClNO5S |
| Molecular Weight | 327.75 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | methyl 2-[(5E)-5-[(3-chloro-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COC(=O)CN1C(=O)S/C(=C/c2ccc(O)c(Cl)c2)C1=O |
| InChI | InChI=1S/C13H10ClNO5S/c1-20-11(17)6-15-12(18)10(21-13(15)19)5-7-2-3-9(16)8(14)4-7/h2-5,16H,6H2,1H3/b10-5+ |
| InChIKey | KFGVGVHQVGMSNP-BJMVGYQFSA-N |
| XLogP | 2.25 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.75 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|