C13H9BrClNO5S — CID 2177954
methyl 2-[(5E)-5-[(3-bromo-5-chloro-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 2177954) has the molecular formula C13H9BrClNO5S and a molecular weight of 406.64 g/mol. Its IUPAC name is methyl 2-[(5E)-5-[(3-bromo-5-chloro-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[(5E)-5-[(3-bromo-5-chloro-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 2177954 |
| Molecular Formula | C13H9BrClNO5S |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 404.91 |
| IUPAC Name | methyl 2-[(5E)-5-[(3-bromo-5-chloro-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COC(=O)CN1C(=O)S/C(=C/c2cc(Cl)c(O)c(Br)c2)C1=O |
| InChI | InChI=1S/C13H9BrClNO5S/c1-21-10(17)5-16-12(19)9(22-13(16)20)4-6-2-7(14)11(18)8(15)3-6/h2-4,18H,5H2,1H3/b9-4+ |
| InChIKey | HDRLGVSTRJRFJN-RUDMXATFSA-N |
| XLogP | 3.02 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|