C14H12BrNO5S2 — CID 1367694
methyl 2-[(5Z)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 1367694) has the molecular formula C14H12BrNO5S2 and a molecular weight of 418.29 g/mol. Its IUPAC name is methyl 2-[(5Z)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[(5Z)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 1367694 |
| Molecular Formula | C14H12BrNO5S2 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 416.93 |
| IUPAC Name | methyl 2-[(5Z)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | COC(=O)CN1C(=O)/C(=C/c2cc(Br)c(O)c(OC)c2)SC1=S |
| InChI | InChI=1S/C14H12BrNO5S2/c1-20-9-4-7(3-8(15)12(9)18)5-10-13(19)16(14(22)23-10)6-11(17)21-2/h3-5,18H,6H2,1-2H3/b10-5- |
| InChIKey | MSFIDAOGTXQGGE-YHYXMXQVSA-N |
| XLogP | 2.54 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|