C16H16N2O7S2 — CID 16629344
2-[[2-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]acetic acid (PubChem CID 16629344) has the molecular formula C16H16N2O7S2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-[[2-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 16629344 |
| Molecular Formula | C16H16N2O7S2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 2-[[2-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]acetic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(CC(=O)NCC(=O)O)C2=O)cc(OC)c1O |
| InChI | InChI=1S/C16H16N2O7S2/c1-24-9-3-8(4-10(25-2)14(9)22)5-11-15(23)18(16(26)27-11)7-12(19)17-6-13(20)21/h3-5,22H,6-7H2,1-2H3,(H,17,19)(H,20,21)/b11-5- |
| InChIKey | PPPUCJHWVHUKIY-WZUFQYTHSA-N |
| XLogP | 0.81 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|