C19H22N2O7S2 — CID 16630572
2-[4-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]propanoic acid (PubChem CID 16630572) has the molecular formula C19H22N2O7S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[4-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]propanoic acid.
| Compound Name | 2-[4-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]propanoic acid |
|---|---|
| PubChem CID | 16630572 |
| Molecular Formula | C19H22N2O7S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 2-[4-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]propanoic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(CCCC(=O)NC(C)C(=O)O)C2=O)cc(OC)c1O |
| InChI | InChI=1S/C19H22N2O7S2/c1-10(18(25)26)20-15(22)5-4-6-21-17(24)14(30-19(21)29)9-11-7-12(27-2)16(23)13(8-11)28-3/h7-10,23H,4-6H2,1-3H3,(H,20,22)(H,25,26)/b14-9- |
| InChIKey | RVETVQJUFHIHLB-ZROIWOOFSA-N |
| XLogP | 1.98 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|