C17H18N2O5S2 — CID 7657534
(2S)-2-[3-[(5E)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]propanoic acid (PubChem CID 7657534) has the molecular formula C17H18N2O5S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is (2S)-2-[3-[(5E)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]propanoic acid.
| Compound Name | (2S)-2-[3-[(5E)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 7657534 |
| Molecular Formula | C17H18N2O5S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | (2S)-2-[3-[(5E)-5-[(4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]propanoic acid |
| SMILES | COc1ccc(/C=C2/SC(=S)N(CCC(=O)N[C@@H](C)C(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C17H18N2O5S2/c1-10(16(22)23)18-14(20)7-8-19-15(21)13(26-17(19)25)9-11-3-5-12(24-2)6-4-11/h3-6,9-10H,7-8H2,1-2H3,(H,18,20)(H,22,23)/b13-9+/t10-/m0/s1 |
| InChIKey | WYDIQRUYNXZGPH-YWEFTTLKSA-N |
| XLogP | 1.88 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|