C17H18N2O6S2 — CID 16630588
2-[4-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]propanoic acid (PubChem CID 16630588) has the molecular formula C17H18N2O6S2 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[4-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]propanoic acid.
| Compound Name | 2-[4-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]propanoic acid |
|---|---|
| PubChem CID | 16630588 |
| Molecular Formula | C17H18N2O6S2 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-[4-[(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]propanoic acid |
| SMILES | CC(NC(=O)CCCN1C(=O)/C(=C/c2ccc(O)cc2O)SC1=S)C(=O)O |
| InChI | InChI=1S/C17H18N2O6S2/c1-9(16(24)25)18-14(22)3-2-6-19-15(23)13(27-17(19)26)7-10-4-5-11(20)8-12(10)21/h4-5,7-9,20-21H,2-3,6H2,1H3,(H,18,22)(H,24,25)/b13-7- |
| InChIKey | SCLQLYGZVMBPTI-QPEQYQDCSA-N |
| XLogP | 1.67 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|