C15H14INO5S2 — CID 1401630
ethyl 2-[5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 1401630) has the molecular formula C15H14INO5S2 and a molecular weight of 479.32 g/mol. Its IUPAC name is ethyl 2-[5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 1401630 |
| Molecular Formula | C15H14INO5S2 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 478.94 |
| IUPAC Name | ethyl 2-[5-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=Cc2cc(I)c(O)c(OC)c2)SC1=S |
| InChI | InChI=1S/C15H14INO5S2/c1-3-22-12(18)7-17-14(20)11(24-15(17)23)6-8-4-9(16)13(19)10(5-8)21-2/h4-6,19H,3,7H2,1-2H3 |
| InChIKey | IOGOTAPWGZCRBN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|