C17H18N2O7S2 — CID 19182479
2-methylpropyl 2-[(5Z)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 19182479) has the molecular formula C17H18N2O7S2 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-methylpropyl 2-[(5Z)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-methylpropyl 2-[(5Z)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 19182479 |
| Molecular Formula | C17H18N2O7S2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 2-methylpropyl 2-[(5Z)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | COc1cc(/C=C2\SC(=S)N(CC(=O)OCC(C)C)C2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H18N2O7S2/c1-9(2)8-26-14(20)7-18-16(22)13(28-17(18)27)6-10-4-11(19(23)24)15(21)12(5-10)25-3/h4-6,9,21H,7-8H2,1-3H3/b13-6- |
| InChIKey | PZGOCRSHBIFMTB-MLPAPPSSSA-N |
| XLogP | 2.71 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|