C24H24ClNO5S2 — CID 19182837
2-methylpropyl 2-[(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 19182837) has the molecular formula C24H24ClNO5S2 and a molecular weight of 506.05 g/mol. Its IUPAC name is 2-methylpropyl 2-[(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-methylpropyl 2-[(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 19182837 |
| Molecular Formula | C24H24ClNO5S2 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | 2-methylpropyl 2-[(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | COc1cc(/C=C2\SC(=S)N(CC(=O)OCC(C)C)C2=O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24ClNO5S2/c1-15(2)13-31-22(27)12-26-23(28)21(33-24(26)32)11-17-6-9-19(20(10-17)29-3)30-14-16-4-7-18(25)8-5-16/h4-11,15H,12-14H2,1-3H3/b21-11- |
| InChIKey | BDGQSHBLTOEUGK-NHDPSOOVSA-N |
| XLogP | 5.33 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|