C25H27NO5S2 — CID 19183029
2-methylpropyl 2-[(5Z)-5-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 19183029) has the molecular formula C25H27NO5S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is 2-methylpropyl 2-[(5Z)-5-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-methylpropyl 2-[(5Z)-5-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 19183029 |
| Molecular Formula | C25H27NO5S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 2-methylpropyl 2-[(5Z)-5-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | COc1cc(/C=C2\SC(=S)N(CC(=O)OCC(C)C)C2=O)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C25H27NO5S2/c1-16(2)14-31-23(27)13-26-24(28)22(33-25(26)32)12-18-9-10-20(21(11-18)29-4)30-15-19-8-6-5-7-17(19)3/h5-12,16H,13-15H2,1-4H3/b22-12- |
| InChIKey | HHBULSZVFWQTKL-UUYOSTAYSA-N |
| XLogP | 4.98 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|