C26H21NO5S2 — CID 19176822
4-[(5Z)-5-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 19176822) has the molecular formula C26H21NO5S2 and a molecular weight of 491.59 g/mol. Its IUPAC name is 4-[(5Z)-5-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 4-[(5Z)-5-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 19176822 |
| Molecular Formula | C26H21NO5S2 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 4-[(5Z)-5-[[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(c3ccc(C(=O)O)cc3)C2=O)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C26H21NO5S2/c1-16-5-3-4-6-19(16)15-32-21-12-7-17(13-22(21)31-2)14-23-24(28)27(26(33)34-23)20-10-8-18(9-11-20)25(29)30/h3-14H,15H2,1-2H3,(H,29,30)/b23-14- |
| InChIKey | UEWXONRYXCEQOT-UCQKPKSFSA-N |
| XLogP | 5.69 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|