C18H12NO5S2- — CID 54725482
4-[(Z)-[3-(4-carboxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenolate (PubChem CID 54725482) has the molecular formula C18H12NO5S2- and a molecular weight of 386.43 g/mol. Its IUPAC name is 4-[(Z)-[3-(4-carboxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenolate.
| Compound Name | 4-[(Z)-[3-(4-carboxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenolate |
|---|---|
| PubChem CID | 54725482 |
| Molecular Formula | C18H12NO5S2- |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 4-[(Z)-[3-(4-carboxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenolate |
| SMILES | COc1cc(/C=C2\SC(=S)N(c3ccc(C(=O)O)cc3)C2=O)ccc1[O-] |
| InChI | InChI=1S/C18H13NO5S2/c1-24-14-8-10(2-7-13(14)20)9-15-16(21)19(18(25)26-15)12-5-3-11(4-6-12)17(22)23/h2-9,20H,1H3,(H,22,23)/p-1/b15-9- |
| InChIKey | MLBIXYSBUNQOPP-DHDCSXOGSA-M |
| XLogP | 2.87 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|