C21H19NO6S2 — CID 2791184
methyl 4-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]benzoate (PubChem CID 2791184) has the molecular formula C21H19NO6S2 and a molecular weight of 445.52 g/mol. Its IUPAC name is methyl 4-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | methyl 4-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 2791184 |
| Molecular Formula | C21H19NO6S2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | methyl 4-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)C(=Cc3cc(OC)c(OC)c(OC)c3)SC2=S)cc1 |
| InChI | InChI=1S/C21H19NO6S2/c1-25-15-9-12(10-16(26-2)18(15)27-3)11-17-19(23)22(21(29)30-17)14-7-5-13(6-8-14)20(24)28-4/h5-11H,1-4H3 |
| InChIKey | QYQCSCQPHGPTHW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|