C17H10NO4S2- — CID 54725420
3-[(E)-[3-(4-carboxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenolate (PubChem CID 54725420) has the molecular formula C17H10NO4S2- and a molecular weight of 356.40 g/mol. Its IUPAC name is 3-[(E)-[3-(4-carboxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenolate.
| Compound Name | 3-[(E)-[3-(4-carboxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenolate |
|---|---|
| PubChem CID | 54725420 |
| Molecular Formula | C17H10NO4S2- |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 3-[(E)-[3-(4-carboxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenolate |
| SMILES | O=C(O)c1ccc(N2C(=O)/C(=C\c3cccc([O-])c3)SC2=S)cc1 |
| InChI | InChI=1S/C17H11NO4S2/c19-13-3-1-2-10(8-13)9-14-15(20)18(17(23)24-14)12-6-4-11(5-7-12)16(21)22/h1-9,19H,(H,21,22)/p-1/b14-9+ |
| InChIKey | YHQGKKZNBAMSGL-NTEUORMPSA-M |
| XLogP | 2.86 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|