C17H10BrNO4S2 — CID 19174052
4-[(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 19174052) has the molecular formula C17H10BrNO4S2 and a molecular weight of 436.31 g/mol. Its IUPAC name is 4-[(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 4-[(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 19174052 |
| Molecular Formula | C17H10BrNO4S2 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 434.92 |
| IUPAC Name | 4-[(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)/C(=C\c3ccc(O)c(Br)c3)SC2=S)cc1 |
| InChI | InChI=1S/C17H10BrNO4S2/c18-12-7-9(1-6-13(12)20)8-14-15(21)19(17(24)25-14)11-4-2-10(3-5-11)16(22)23/h1-8,20H,(H,22,23)/b14-8+ |
| InChIKey | VUHCRRBLOGHKEP-RIYZIHGNSA-N |
| XLogP | 4.26 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|