C26H20N2O6S2 — CID 6274994
4-[[2-[2-methoxy-4-[(Z)-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetyl]amino]benzoic acid (PubChem CID 6274994) has the molecular formula C26H20N2O6S2 and a molecular weight of 520.59 g/mol. Its IUPAC name is 4-[[2-[2-methoxy-4-[(Z)-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[2-methoxy-4-[(Z)-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 6274994 |
| Molecular Formula | C26H20N2O6S2 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | 4-[[2-[2-methoxy-4-[(Z)-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetyl]amino]benzoic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(c3ccccc3)C2=O)ccc1OCC(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H20N2O6S2/c1-33-21-13-16(14-22-24(30)28(26(35)36-22)19-5-3-2-4-6-19)7-12-20(21)34-15-23(29)27-18-10-8-17(9-11-18)25(31)32/h2-14H,15H2,1H3,(H,27,29)(H,31,32)/b22-14- |
| InChIKey | ALDGLKIXHJOHRR-HMAPJEAMSA-N |
| XLogP | 4.82 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|