C27H23FN2O5S2 — CID 126258972
N-(4-ethoxyphenyl)-2-[4-[(Z)-[3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide (PubChem CID 126258972) has the molecular formula C27H23FN2O5S2 and a molecular weight of 538.62 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[4-[(Z)-[3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[4-[(Z)-[3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126258972 |
| Molecular Formula | C27H23FN2O5S2 |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[4-[(Z)-[3-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetamide |
| SMILES | CCOc1ccc(NC(=O)COc2ccc(/C=C3\SC(=S)N(c4ccc(F)cc4)C3=O)cc2OC)cc1 |
| InChI | InChI=1S/C27H23FN2O5S2/c1-3-34-21-11-7-19(8-12-21)29-25(31)16-35-22-13-4-17(14-23(22)33-2)15-24-26(32)30(27(36)37-24)20-9-5-18(28)6-10-20/h4-15H,3,16H2,1-2H3,(H,29,31)/b24-15- |
| InChIKey | TWVRTPUWPOHYCC-IWIPYMOSSA-N |
| XLogP | 5.66 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|