C28H26N2O6S2 — CID 126243002
2-[2-ethoxy-4-[(Z)-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-methoxyphenyl)acetamide (PubChem CID 126243002) has the molecular formula C28H26N2O6S2 and a molecular weight of 550.66 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(Z)-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(Z)-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126243002 |
| Molecular Formula | C28H26N2O6S2 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | 2-[2-ethoxy-4-[(Z)-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-methoxyphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(c3ccc(OC)cc3)C2=O)ccc1OCC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C28H26N2O6S2/c1-4-35-24-14-18(8-13-23(24)36-17-26(31)29-19-6-5-7-22(16-19)34-3)15-25-27(32)30(28(37)38-25)20-9-11-21(33-2)12-10-20/h5-16H,4,17H2,1-3H3,(H,29,31)/b25-15- |
| InChIKey | HGEJQVZYZCLCMM-MYYYXRDXSA-N |
| XLogP | 5.53 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|