C18H20N2O8S — CID 126216421
2-methylpropyl 2-[(5Z)-5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126216421) has the molecular formula C18H20N2O8S and a molecular weight of 424.43 g/mol. Its IUPAC name is 2-methylpropyl 2-[(5Z)-5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-methylpropyl 2-[(5Z)-5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126216421 |
| Molecular Formula | C18H20N2O8S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 2-methylpropyl 2-[(5Z)-5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)OCC(C)C)C2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H20N2O8S/c1-4-27-13-6-11(5-12(16(13)22)20(25)26)7-14-17(23)19(18(24)29-14)8-15(21)28-9-10(2)3/h5-7,10,22H,4,8-9H2,1-3H3/b14-7- |
| InChIKey | IRDXGHHSFTZTDI-AUWJEWJLSA-N |
| XLogP | 2.93 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|